C49H98NO6+ — CID 24898475
2,3-bis[(Z)-octadec-9-enoxy]propyl-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]-dimethylazanium (PubChem CID 24898475) has the molecular formula C49H98NO6+ and a molecular weight of 797.32 g/mol. Its IUPAC name is 2,3-bis[(Z)-octadec-9-enoxy]propyl-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]-dimethylazanium.
| Compound Name | 2,3-bis[(Z)-octadec-9-enoxy]propyl-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 24898475 |
| Molecular Formula | C49H98NO6+ |
| Molecular Weight | 797.32 g/mol |
| Exact Mass | 796.74 |
| IUPAC Name | 2,3-bis[(Z)-octadec-9-enoxy]propyl-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]-dimethylazanium |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOCC(C[N+](C)(C)CCOCCOCCOCCO)OCCCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C49H98NO6/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-39-55-48-49(47-50(3,4)37-41-52-43-45-54-46-44-53-42-38-51)56-40-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h19-22,49,51H,5-18,23-48H2,1-4H3/q+1/b21-19-,22-20- |
| InChIKey | JSHWJNWIPRUYLY-WRBBJXAJSA-N |
| XLogP | 12.58 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.32 |
| LogP ≤ 5 | 12.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|