C63H126NO12+ — CID 59411751
6,6-bis[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]hexyl-[2,3-bis[(Z)-octadec-9-enoxy]propyl]-dimethylazanium (PubChem CID 59411751) has the molecular formula C63H126NO12+ and a molecular weight of 1089.70 g/mol. Its IUPAC name is 6,6-bis[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]hexyl-[2,3-bis[(Z)-octadec-9-enoxy]propyl]-dimethylazanium.
| Compound Name | 6,6-bis[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]hexyl-[2,3-bis[(Z)-octadec-9-enoxy]propyl]-dimethylazanium |
|---|---|
| PubChem CID | 59411751 |
| Molecular Formula | C63H126NO12+ |
| Molecular Weight | 1089.70 g/mol |
| Exact Mass | 1088.93 |
| IUPAC Name | 6,6-bis[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]hexyl-[2,3-bis[(Z)-octadec-9-enoxy]propyl]-dimethylazanium |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOCC(C[N+](C)(C)CCCCCC(OCCOCCOCCOCCO)OCCOCCOCCOCCO)OCCCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C63H126NO12/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-38-44-73-61-62(74-45-39-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2)60-64(3,4)41-37-35-36-40-63(75-58-56-71-54-52-69-50-48-67-46-42-65)76-59-57-72-55-53-70-51-49-68-47-43-66/h19-22,62-63,65-66H,5-18,23-61H2,1-4H3/q+1/b21-19-,22-20- |
| InChIKey | FYOGNNJGLUOTTN-WRBBJXAJSA-N |
| XLogP | 13.54 |
| TPSA | 132.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 67 |
| Heavy Atoms | 76 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1089.70 |
| LogP ≤ 5 | 13.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|