C54H111ClN6O3 — CID 172946136
2-[[(2S)-2,5-bis(3-aminopropylamino)pentanoyl]amino]ethyl-[2,3-bis[(Z)-octadec-9-enoxy]propyl]-dimethylazanium chloride (PubChem CID 172946136) has the molecular formula C54H111ClN6O3 and a molecular weight of 927.97 g/mol. Its IUPAC name is 2-[[(2S)-2,5-bis(3-aminopropylamino)pentanoyl]amino]ethyl-[2,3-bis[(Z)-octadec-9-enoxy]propyl]-dimethylazanium chloride.
| Compound Name | 2-[[(2S)-2,5-bis(3-aminopropylamino)pentanoyl]amino]ethyl-[2,3-bis[(Z)-octadec-9-enoxy]propyl]-dimethylazanium chloride |
|---|---|
| PubChem CID | 172946136 |
| Molecular Formula | C54H111ClN6O3 |
| Molecular Weight | 927.97 g/mol |
| Exact Mass | 926.84 |
| IUPAC Name | 2-[[(2S)-2,5-bis(3-aminopropylamino)pentanoyl]amino]ethyl-[2,3-bis[(Z)-octadec-9-enoxy]propyl]-dimethylazanium chloride |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOCC(C[N+](C)(C)CCNC(=O)[C@H](CCCNCCCN)NCCCN)OCCCCCCCC/C=C\CCCCCCCC.[Cl-] |
| InChI | InChI=1S/C54H110N6O3.ClH/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-48-62-51-52(63-49-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2)50-60(3,4)47-46-59-54(61)53(58-45-39-42-56)40-37-43-57-44-38-41-55;/h19-22,52-53,57-58H,5-18,23-51,55-56H2,1-4H3;1H/b21-19-,22-20-;/t52?,53-;/m0./s1 |
| InChIKey | YJEJICSHQPJYAJ-QKQXJFDWSA-N |
| XLogP | 8.69 |
| TPSA | 123.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 52 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 927.97 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|