C21H44NO4+ — CID 87254511
2-acetyloxyethyl-(2,3-dihexoxypropyl)-dimethylazanium (PubChem CID 87254511) has the molecular formula C21H44NO4+ and a molecular weight of 374.59 g/mol. Its IUPAC name is 2-acetyloxyethyl-(2,3-dihexoxypropyl)-dimethylazanium.
| Compound Name | 2-acetyloxyethyl-(2,3-dihexoxypropyl)-dimethylazanium |
|---|---|
| PubChem CID | 87254511 |
| Molecular Formula | C21H44NO4+ |
| Molecular Weight | 374.59 g/mol |
| Exact Mass | 374.33 |
| IUPAC Name | 2-acetyloxyethyl-(2,3-dihexoxypropyl)-dimethylazanium |
| SMILES | CCCCCCOCC(C[N+](C)(C)CCOC(C)=O)OCCCCCC |
| InChI | InChI=1S/C21H44NO4/c1-6-8-10-12-15-24-19-21(26-16-13-11-9-7-2)18-22(4,5)14-17-25-20(3)23/h21H,6-19H2,1-5H3/q+1 |
| InChIKey | VRWQKRBBUVVYGY-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.59 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|