C32H65NO6 — CID 11505020
2-[2-[2-[2-[4-(dimethylamino)-2-[(Z)-octadec-9-enoxy]butoxy]ethoxy]ethoxy]ethoxy]ethanol (PubChem CID 11505020) has the molecular formula C32H65NO6 and a molecular weight of 559.87 g/mol. Its IUPAC name is 2-[2-[2-[2-[4-(dimethylamino)-2-[(Z)-octadec-9-enoxy]butoxy]ethoxy]ethoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[2-[2-[4-(dimethylamino)-2-[(Z)-octadec-9-enoxy]butoxy]ethoxy]ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 11505020 |
| Molecular Formula | C32H65NO6 |
| Molecular Weight | 559.87 g/mol |
| Exact Mass | 559.48 |
| IUPAC Name | 2-[2-[2-[2-[4-(dimethylamino)-2-[(Z)-octadec-9-enoxy]butoxy]ethoxy]ethoxy]ethoxy]ethanol |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOC(CCN(C)C)COCCOCCOCCOCCO |
| InChI | InChI=1S/C32H65NO6/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23-39-32(20-21-33(2)3)31-38-30-29-37-28-27-36-26-25-35-24-22-34/h11-12,32,34H,4-10,13-31H2,1-3H3/b12-11- |
| InChIKey | LNHTWONQHXNRJG-QXMHVHEDSA-N |
| XLogP | 6.42 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.87 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|