C42H80N2 — CID 89215982
N'-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]-N-propylethane-1,2-diamine (PubChem CID 89215982) has the molecular formula C42H80N2 and a molecular weight of 613.12 g/mol. Its IUPAC name is N'-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]-N-propylethane-1,2-diamine.
| Compound Name | N'-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]-N-propylethane-1,2-diamine |
|---|---|
| PubChem CID | 89215982 |
| Molecular Formula | C42H80N2 |
| Molecular Weight | 613.12 g/mol |
| Exact Mass | 612.63 |
| IUPAC Name | N'-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]-N-propylethane-1,2-diamine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)NCCNCCC |
| InChI | InChI=1S/C42H80N2/c1-4-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-42(44-41-40-43-39-6-3)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-5-2/h13-16,19-22,42-44H,4-12,17-18,23-41H2,1-3H3/b15-13-,16-14-,21-19-,22-20- |
| InChIKey | KIXDEKXRMITSNR-KWXKLSQISA-N |
| XLogP | 13.35 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.12 |
| LogP ≤ 5 | 13.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|