C43H77N3 — CID 71554451
(6Z,9Z,28Z,31Z)-N-[3-(1H-imidazol-5-yl)propyl]heptatriaconta-6,9,28,31-tetraen-19-amine (PubChem CID 71554451) has the molecular formula C43H77N3 and a molecular weight of 636.11 g/mol. Its IUPAC name is (6Z,9Z,28Z,31Z)-N-[3-(1H-imidazol-5-yl)propyl]heptatriaconta-6,9,28,31-tetraen-19-amine.
| Compound Name | (6Z,9Z,28Z,31Z)-N-[3-(1H-imidazol-5-yl)propyl]heptatriaconta-6,9,28,31-tetraen-19-amine |
|---|---|
| PubChem CID | 71554451 |
| Molecular Formula | C43H77N3 |
| Molecular Weight | 636.11 g/mol |
| Exact Mass | 635.61 |
| IUPAC Name | (6Z,9Z,28Z,31Z)-N-[3-(1H-imidazol-5-yl)propyl]heptatriaconta-6,9,28,31-tetraen-19-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)NCCCc1cnc[nH]1 |
| InChI | InChI=1S/C43H77N3/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-36-42(45-39-35-38-43-40-44-41-46-43)37-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,40-42,45H,3-10,15-16,21-39H2,1-2H3,(H,44,46)/b13-11-,14-12-,19-17-,20-18- |
| InChIKey | LSACIKIXWQPENW-MAZCIEHSSA-N |
| XLogP | 13.71 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.11 |
| LogP ≤ 5 | 13.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|