C38H69NO2 — CID 138524490
[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]carbamic acid (PubChem CID 138524490) has the molecular formula C38H69NO2 and a molecular weight of 571.98 g/mol. Its IUPAC name is [(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]carbamic acid.
| Compound Name | [(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]carbamic acid |
|---|---|
| PubChem CID | 138524490 |
| Molecular Formula | C38H69NO2 |
| Molecular Weight | 571.98 g/mol |
| Exact Mass | 571.53 |
| IUPAC Name | [(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]carbamic acid |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)NC(=O)O |
| InChI | InChI=1S/C38H69NO2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37(39-38(40)41)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,37,39H,3-10,15-16,21-36H2,1-2H3,(H,40,41)/b13-11-,14-12-,19-17-,20-18- |
| InChIKey | IDAHQYKPKJNUCT-MAZCIEHSSA-N |
| XLogP | 13.03 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.98 |
| LogP ≤ 5 | 13.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|