C40H72N2O3 — CID 174259171
3-[[(6E,8Z,27Z,30Z)-hexatriaconta-6,8,27,30-tetraen-18-yl]carbamoylamino]propanoic acid (PubChem CID 174259171) has the molecular formula C40H72N2O3 and a molecular weight of 629.03 g/mol. Its IUPAC name is 3-[[(6E,8Z,27Z,30Z)-hexatriaconta-6,8,27,30-tetraen-18-yl]carbamoylamino]propanoic acid.
| Compound Name | 3-[[(6E,8Z,27Z,30Z)-hexatriaconta-6,8,27,30-tetraen-18-yl]carbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 174259171 |
| Molecular Formula | C40H72N2O3 |
| Molecular Weight | 629.03 g/mol |
| Exact Mass | 628.55 |
| IUPAC Name | 3-[[(6E,8Z,27Z,30Z)-hexatriaconta-6,8,27,30-tetraen-18-yl]carbamoylamino]propanoic acid |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C=C\CCCCC)NC(=O)NCCC(=O)O |
| InChI | InChI=1S/C40H72N2O3/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-38(42-40(45)41-37-36-39(43)44)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,16-19,38H,3-10,15,20-37H2,1-2H3,(H,43,44)(H2,41,42,45)/b13-11-,14-12+,18-16-,19-17- |
| InChIKey | VQNMTSPNJRZNFU-SIGNWNTQSA-N |
| XLogP | 12.15 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.03 |
| LogP ≤ 5 | 12.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|