octadeca-6,9,11-trienoic acid

C18H30O2 — CID 85068576

IUPACoctadeca-6,9,11-trienoic acid
SMILESCCCCCCC=CC=CCC=CCCCCC(=O)O
InChIInChI=1S/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h7-10,12-13H,2-6,11,14-17H2,1H3,(H,19,20)
InChIKeyZVFWWMZFFBSDTB-UHFFFAOYSA-N
MW278.44 g/mol
LogP5.66
Rot. Bonds13

About octadeca-6,9,11-trienoic acid

octadeca-6,9,11-trienoic acid (PubChem CID 85068576) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is octadeca-6,9,11-trienoic acid.

Molecular Properties

Compound Nameoctadeca-6,9,11-trienoic acid
PubChem CID85068576
Molecular FormulaC18H30O2
Molecular Weight278.44 g/mol
Exact Mass278.22
IUPAC Nameoctadeca-6,9,11-trienoic acid
SMILESCCCCCCC=CC=CCC=CCCCCC(=O)O
InChIInChI=1S/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h7-10,12-13H,2-6,11,14-17H2,1H3,(H,19,20)
InChIKeyZVFWWMZFFBSDTB-UHFFFAOYSA-N
XLogP5.66
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds13
Heavy Atoms20
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500278.44
LogP ≤ 55.66
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze octadeca-6,9,11-trienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of octadeca-6,9,11-trienoic acid?
The IUPAC name of octadeca-6,9,11-trienoic acid (CID 85068576) is octadeca-6,9,11-trienoic acid.
What is the SMILES notation for octadeca-6,9,11-trienoic acid?
The canonical SMILES for octadeca-6,9,11-trienoic acid is CCCCCCC=CC=CCC=CCCCCC(=O)O.
What is the InChIKey of octadeca-6,9,11-trienoic acid?
The InChIKey is ZVFWWMZFFBSDTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h7-10,12-13H,2-6,11,14-17H2,1H3,(H,19,20).
What are the key properties of octadeca-6,9,11-trienoic acid?
octadeca-6,9,11-trienoic acid has a molecular weight of 278.44 g/mol, XLogP of 5.66, 13 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for octadeca-6,9,11-trienoic acid is sourced from PubChem (CID 85068576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).