C18H35N — CID 140562602
(9Z,12Z)-octadeca-9,12-dien-4-amine (PubChem CID 140562602) has the molecular formula C18H35N and a molecular weight of 265.48 g/mol. Its IUPAC name is (9Z,12Z)-octadeca-9,12-dien-4-amine.
| Compound Name | (9Z,12Z)-octadeca-9,12-dien-4-amine |
|---|---|
| PubChem CID | 140562602 |
| Molecular Formula | C18H35N |
| Molecular Weight | 265.48 g/mol |
| Exact Mass | 265.28 |
| IUPAC Name | (9Z,12Z)-octadeca-9,12-dien-4-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCC(N)CCC |
| InChI | InChI=1S/C18H35N/c1-3-5-6-7-8-9-10-11-12-13-14-15-17-18(19)16-4-2/h8-9,11-12,18H,3-7,10,13-17,19H2,1-2H3/b9-8-,12-11- |
| InChIKey | PGPVTDWMDFURTK-MURFETPASA-N |
| XLogP | 5.76 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.48 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|