About 2-morpholin-4-ylethyl 4-ethynylbenzoate;hydrochloride
2-morpholin-4-ylethyl 4-ethynylbenzoate;hydrochloride (PubChem CID 71386007) has the molecular formula C15H18ClNO3
and a molecular weight of 295.77 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl 4-ethynylbenzoate;hydrochloride.
Molecular Properties
| Compound Name | 2-morpholin-4-ylethyl 4-ethynylbenzoate;hydrochloride |
| PubChem CID | 71386007 |
| Molecular Formula | C15H18ClNO3 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 2-morpholin-4-ylethyl 4-ethynylbenzoate;hydrochloride |
| SMILES | C#Cc1ccc(C(=O)OCCN2CCOCC2)cc1.Cl |
| InChI | InChI=1S/C15H17NO3.ClH/c1-2-13-3-5-14(6-4-13)15(17)19-12-9-16-7-10-18-11-8-16;/h1,3-6H,7-12H2;1H |
| InChIKey | GEVPFDDKVHZSAW-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-morpholin-4-ylethyl 4-ethynylbenzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-4-ylethyl 4-ethynylbenzoate;hydrochloride?
The IUPAC name of 2-morpholin-4-ylethyl 4-ethynylbenzoate;hydrochloride (CID 71386007) is 2-morpholin-4-ylethyl 4-ethynylbenzoate;hydrochloride.
What is the SMILES notation for 2-morpholin-4-ylethyl 4-ethynylbenzoate;hydrochloride?
The canonical SMILES for 2-morpholin-4-ylethyl 4-ethynylbenzoate;hydrochloride is C#Cc1ccc(C(=O)OCCN2CCOCC2)cc1.Cl.
What is the InChIKey of 2-morpholin-4-ylethyl 4-ethynylbenzoate;hydrochloride?
The InChIKey is GEVPFDDKVHZSAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO3.ClH/c1-2-13-3-5-14(6-4-13)15(17)19-12-9-16-7-10-18-11-8-16;/h1,3-6H,7-12H2;1H.
What are the key properties of 2-morpholin-4-ylethyl 4-ethynylbenzoate;hydrochloride?
2-morpholin-4-ylethyl 4-ethynylbenzoate;hydrochloride has a molecular weight of 295.77 g/mol, XLogP of 1.58, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-4-ylethyl 4-ethynylbenzoate;hydrochloride is sourced from PubChem (CID 71386007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).