C17H22Cl2FN3O2 — CID 2319024
1-[2,2-dichloro-1-(3-fluoro-4-methylphenyl)ethenyl]-3-(3-morpholin-4-ylpropyl)urea (PubChem CID 2319024) has the molecular formula C17H22Cl2FN3O2 and a molecular weight of 390.29 g/mol. Its IUPAC name is 1-[2,2-dichloro-1-(3-fluoro-4-methylphenyl)ethenyl]-3-(3-morpholin-4-ylpropyl)urea.
| Compound Name | 1-[2,2-dichloro-1-(3-fluoro-4-methylphenyl)ethenyl]-3-(3-morpholin-4-ylpropyl)urea |
|---|---|
| PubChem CID | 2319024 |
| Molecular Formula | C17H22Cl2FN3O2 |
| Molecular Weight | 390.29 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 1-[2,2-dichloro-1-(3-fluoro-4-methylphenyl)ethenyl]-3-(3-morpholin-4-ylpropyl)urea |
| SMILES | Cc1ccc(C(NC(=O)NCCCN2CCOCC2)=C(Cl)Cl)cc1F |
| InChI | InChI=1S/C17H22Cl2FN3O2/c1-12-3-4-13(11-14(12)20)15(16(18)19)22-17(24)21-5-2-6-23-7-9-25-10-8-23/h3-4,11H,2,5-10H2,1H3,(H2,21,22,24) |
| InChIKey | KPVXEHCPBNMKGD-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.29 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|