C22H19FN6O2S — CID 55811809
N-[2-fluoro-5-(tetrazol-1-yl)phenyl]-5-morpholin-4-yl-4-phenylthiophene-2-carboxamide (PubChem CID 55811809) has the molecular formula C22H19FN6O2S and a molecular weight of 450.50 g/mol. Its IUPAC name is N-[2-fluoro-5-(tetrazol-1-yl)phenyl]-5-morpholin-4-yl-4-phenylthiophene-2-carboxamide.
| Compound Name | N-[2-fluoro-5-(tetrazol-1-yl)phenyl]-5-morpholin-4-yl-4-phenylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 55811809 |
| Molecular Formula | C22H19FN6O2S |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | N-[2-fluoro-5-(tetrazol-1-yl)phenyl]-5-morpholin-4-yl-4-phenylthiophene-2-carboxamide |
| SMILES | O=C(Nc1cc(-n2cnnn2)ccc1F)c1cc(-c2ccccc2)c(N2CCOCC2)s1 |
| InChI | InChI=1S/C22H19FN6O2S/c23-18-7-6-16(29-14-24-26-27-29)12-19(18)25-21(30)20-13-17(15-4-2-1-3-5-15)22(32-20)28-8-10-31-11-9-28/h1-7,12-14H,8-11H2,(H,25,30) |
| InChIKey | ZHJXSJCUHCOEIO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |