C22H20N4O2S — CID 34335922
N-(benzimidazol-1-yl)-5-morpholin-4-yl-4-phenylthiophene-2-carboxamide (PubChem CID 34335922) has the molecular formula C22H20N4O2S and a molecular weight of 404.50 g/mol. Its IUPAC name is N-(benzimidazol-1-yl)-5-morpholin-4-yl-4-phenylthiophene-2-carboxamide.
| Compound Name | N-(benzimidazol-1-yl)-5-morpholin-4-yl-4-phenylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 34335922 |
| Molecular Formula | C22H20N4O2S |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | N-(benzimidazol-1-yl)-5-morpholin-4-yl-4-phenylthiophene-2-carboxamide |
| SMILES | O=C(Nn1cnc2ccccc21)c1cc(-c2ccccc2)c(N2CCOCC2)s1 |
| InChI | InChI=1S/C22H20N4O2S/c27-21(24-26-15-23-18-8-4-5-9-19(18)26)20-14-17(16-6-2-1-3-7-16)22(29-20)25-10-12-28-13-11-25/h1-9,14-15H,10-13H2,(H,24,27) |
| InChIKey | WRSVFKFORGSJIV-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |