C20H21N3O2S — CID 71883045
N-(1-cyanocyclobutyl)-5-morpholin-4-yl-4-phenylthiophene-2-carboxamide (PubChem CID 71883045) has the molecular formula C20H21N3O2S and a molecular weight of 367.47 g/mol. Its IUPAC name is N-(1-cyanocyclobutyl)-5-morpholin-4-yl-4-phenylthiophene-2-carboxamide.
| Compound Name | N-(1-cyanocyclobutyl)-5-morpholin-4-yl-4-phenylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 71883045 |
| Molecular Formula | C20H21N3O2S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | N-(1-cyanocyclobutyl)-5-morpholin-4-yl-4-phenylthiophene-2-carboxamide |
| SMILES | N#CC1(NC(=O)c2cc(-c3ccccc3)c(N3CCOCC3)s2)CCC1 |
| InChI | InChI=1S/C20H21N3O2S/c21-14-20(7-4-8-20)22-18(24)17-13-16(15-5-2-1-3-6-15)19(26-17)23-9-11-25-12-10-23/h1-3,5-6,13H,4,7-12H2,(H,22,24) |
| InChIKey | YVGQQUCGCSXMOX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |