C25H26N2O4S — CID 24516873
methyl 3-[(5-morpholin-4-yl-4-phenylthiophene-2-carbonyl)amino]-3-phenylpropanoate (PubChem CID 24516873) has the molecular formula C25H26N2O4S and a molecular weight of 450.56 g/mol. Its IUPAC name is methyl 3-[(5-morpholin-4-yl-4-phenylthiophene-2-carbonyl)amino]-3-phenylpropanoate.
| Compound Name | methyl 3-[(5-morpholin-4-yl-4-phenylthiophene-2-carbonyl)amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 24516873 |
| Molecular Formula | C25H26N2O4S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | methyl 3-[(5-morpholin-4-yl-4-phenylthiophene-2-carbonyl)amino]-3-phenylpropanoate |
| SMILES | COC(=O)CC(NC(=O)c1cc(-c2ccccc2)c(N2CCOCC2)s1)c1ccccc1 |
| InChI | InChI=1S/C25H26N2O4S/c1-30-23(28)17-21(19-10-6-3-7-11-19)26-24(29)22-16-20(18-8-4-2-5-9-18)25(32-22)27-12-14-31-15-13-27/h2-11,16,21H,12-15,17H2,1H3,(H,26,29) |
| InChIKey | YCKBNMWLCPMMHU-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |