C24H25N3O4S — CID 26781521
N-(5-acetamido-2-methoxyphenyl)-5-morpholin-4-yl-4-phenylthiophene-2-carboxamide (PubChem CID 26781521) has the molecular formula C24H25N3O4S and a molecular weight of 451.55 g/mol. Its IUPAC name is N-(5-acetamido-2-methoxyphenyl)-5-morpholin-4-yl-4-phenylthiophene-2-carboxamide.
| Compound Name | N-(5-acetamido-2-methoxyphenyl)-5-morpholin-4-yl-4-phenylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 26781521 |
| Molecular Formula | C24H25N3O4S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | N-(5-acetamido-2-methoxyphenyl)-5-morpholin-4-yl-4-phenylthiophene-2-carboxamide |
| SMILES | COc1ccc(NC(C)=O)cc1NC(=O)c1cc(-c2ccccc2)c(N2CCOCC2)s1 |
| InChI | InChI=1S/C24H25N3O4S/c1-16(28)25-18-8-9-21(30-2)20(14-18)26-23(29)22-15-19(17-6-4-3-5-7-17)24(32-22)27-10-12-31-13-11-27/h3-9,14-15H,10-13H2,1-2H3,(H,25,28)(H,26,29) |
| InChIKey | JRVVWACAIQRINV-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |