C24H24FN3O4S — CID 45354909
N'-[2-(2-fluorophenoxy)propanoyl]-5-morpholin-4-yl-4-phenylthiophene-2-carbohydrazide (PubChem CID 45354909) has the molecular formula C24H24FN3O4S and a molecular weight of 469.54 g/mol. Its IUPAC name is N'-[2-(2-fluorophenoxy)propanoyl]-5-morpholin-4-yl-4-phenylthiophene-2-carbohydrazide.
| Compound Name | N'-[2-(2-fluorophenoxy)propanoyl]-5-morpholin-4-yl-4-phenylthiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 45354909 |
| Molecular Formula | C24H24FN3O4S |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | N'-[2-(2-fluorophenoxy)propanoyl]-5-morpholin-4-yl-4-phenylthiophene-2-carbohydrazide |
| SMILES | CC(Oc1ccccc1F)C(=O)NNC(=O)c1cc(-c2ccccc2)c(N2CCOCC2)s1 |
| InChI | InChI=1S/C24H24FN3O4S/c1-16(32-20-10-6-5-9-19(20)25)22(29)26-27-23(30)21-15-18(17-7-3-2-4-8-17)24(33-21)28-11-13-31-14-12-28/h2-10,15-16H,11-14H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | BIEXSUGGSZCOCK-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|