C25H24N2O6S — CID 35486595
[2-[(2-methoxybenzoyl)amino]-2-oxoethyl] 5-morpholin-4-yl-4-phenylthiophene-2-carboxylate (PubChem CID 35486595) has the molecular formula C25H24N2O6S and a molecular weight of 480.54 g/mol. Its IUPAC name is [2-[(2-methoxybenzoyl)amino]-2-oxoethyl] 5-morpholin-4-yl-4-phenylthiophene-2-carboxylate.
| Compound Name | [2-[(2-methoxybenzoyl)amino]-2-oxoethyl] 5-morpholin-4-yl-4-phenylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 35486595 |
| Molecular Formula | C25H24N2O6S |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | [2-[(2-methoxybenzoyl)amino]-2-oxoethyl] 5-morpholin-4-yl-4-phenylthiophene-2-carboxylate |
| SMILES | COc1ccccc1C(=O)NC(=O)COC(=O)c1cc(-c2ccccc2)c(N2CCOCC2)s1 |
| InChI | InChI=1S/C25H24N2O6S/c1-31-20-10-6-5-9-18(20)23(29)26-22(28)16-33-25(30)21-15-19(17-7-3-2-4-8-17)24(34-21)27-11-13-32-14-12-27/h2-10,15H,11-14,16H2,1H3,(H,26,28,29) |
| InChIKey | QDOYMPNJEBNCIC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |