C11H16N4O4S — CID 24635394
2-(carbamoylamino)-N-[4-(methylsulfamoyl)phenyl]propanamide (PubChem CID 24635394) has the molecular formula C11H16N4O4S and a molecular weight of 300.34 g/mol. Its IUPAC name is 2-(carbamoylamino)-N-[4-(methylsulfamoyl)phenyl]propanamide.
| Compound Name | 2-(carbamoylamino)-N-[4-(methylsulfamoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 24635394 |
| Molecular Formula | C11H16N4O4S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 2-(carbamoylamino)-N-[4-(methylsulfamoyl)phenyl]propanamide |
| SMILES | CNS(=O)(=O)c1ccc(NC(=O)C(C)NC(N)=O)cc1 |
| InChI | InChI=1S/C11H16N4O4S/c1-7(14-11(12)17)10(16)15-8-3-5-9(6-4-8)20(18,19)13-2/h3-7,13H,1-2H3,(H,15,16)(H3,12,14,17) |
| InChIKey | QZQLXYKCHMHRDU-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |