C7H12BrN3O4 — CID 10468960
(2S)-2-amino-3-[[(2S)-4-amino-2-bromo-4-oxobutanoyl]amino]propanoic acid (PubChem CID 10468960) has the molecular formula C7H12BrN3O4 and a molecular weight of 282.09 g/mol. Its IUPAC name is (2S)-2-amino-3-[[(2S)-4-amino-2-bromo-4-oxobutanoyl]amino]propanoic acid.
| Compound Name | (2S)-2-amino-3-[[(2S)-4-amino-2-bromo-4-oxobutanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 10468960 |
| Molecular Formula | C7H12BrN3O4 |
| Molecular Weight | 282.09 g/mol |
| Exact Mass | 281.00 |
| IUPAC Name | (2S)-2-amino-3-[[(2S)-4-amino-2-bromo-4-oxobutanoyl]amino]propanoic acid |
| SMILES | NC(=O)C[C@H](Br)C(=O)NC[C@H](N)C(=O)O |
| InChI | InChI=1S/C7H12BrN3O4/c8-3(1-5(10)12)6(13)11-2-4(9)7(14)15/h3-4H,1-2,9H2,(H2,10,12)(H,11,13)(H,14,15)/t3-,4-/m0/s1 |
| InChIKey | RSOFJWNTWIKUHA-IMJSIDKUSA-N |
| XLogP | -1.85 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.09 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|