C10H21N3O3 — CID 106187946
2-amino-N-(3-hydroxy-2,3-dimethylbutan-2-yl)butanediamide (PubChem CID 106187946) has the molecular formula C10H21N3O3 and a molecular weight of 231.30 g/mol. Its IUPAC name is 2-amino-N-(3-hydroxy-2,3-dimethylbutan-2-yl)butanediamide.
| Compound Name | 2-amino-N-(3-hydroxy-2,3-dimethylbutan-2-yl)butanediamide |
|---|---|
| PubChem CID | 106187946 |
| Molecular Formula | C10H21N3O3 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 2-amino-N-(3-hydroxy-2,3-dimethylbutan-2-yl)butanediamide |
| SMILES | CC(C)(O)C(C)(C)NC(=O)C(N)CC(N)=O |
| InChI | InChI=1S/C10H21N3O3/c1-9(2,10(3,4)16)13-8(15)6(11)5-7(12)14/h6,16H,5,11H2,1-4H3,(H2,12,14)(H,13,15) |
| InChIKey | VIOCMLQRQHEWTK-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |