C10H17N3O4 — CID 61162344
2-cyclopropyl-2-[(2,4-diamino-4-oxobutanoyl)amino]propanoic acid (PubChem CID 61162344) has the molecular formula C10H17N3O4 and a molecular weight of 243.26 g/mol. Its IUPAC name is 2-cyclopropyl-2-[(2,4-diamino-4-oxobutanoyl)amino]propanoic acid.
| Compound Name | 2-cyclopropyl-2-[(2,4-diamino-4-oxobutanoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 61162344 |
| Molecular Formula | C10H17N3O4 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | 2-cyclopropyl-2-[(2,4-diamino-4-oxobutanoyl)amino]propanoic acid |
| SMILES | CC(NC(=O)C(N)CC(N)=O)(C(=O)O)C1CC1 |
| InChI | InChI=1S/C10H17N3O4/c1-10(9(16)17,5-2-3-5)13-8(15)6(11)4-7(12)14/h5-6H,2-4,11H2,1H3,(H2,12,14)(H,13,15)(H,16,17) |
| InChIKey | JRRZCFDJRHKSKO-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |