C10H14N2O3 — CID 24708312
2-cyclopropyl-2-(prop-2-ynylcarbamoylamino)propanoic acid (PubChem CID 24708312) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is 2-cyclopropyl-2-(prop-2-ynylcarbamoylamino)propanoic acid.
| Compound Name | 2-cyclopropyl-2-(prop-2-ynylcarbamoylamino)propanoic acid |
|---|---|
| PubChem CID | 24708312 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 2-cyclopropyl-2-(prop-2-ynylcarbamoylamino)propanoic acid |
| SMILES | C#CCNC(=O)NC(C)(C(=O)O)C1CC1 |
| InChI | InChI=1S/C10H14N2O3/c1-3-6-11-9(15)12-10(2,8(13)14)7-4-5-7/h1,7H,4-6H2,2H3,(H,13,14)(H2,11,12,15) |
| InChIKey | TVYXZLJNZYLXIS-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|