C9H17N3O3 — CID 61402734
2-(2-aminoethylcarbamoylamino)-2-cyclopropylpropanoic acid (PubChem CID 61402734) has the molecular formula C9H17N3O3 and a molecular weight of 215.25 g/mol. Its IUPAC name is 2-(2-aminoethylcarbamoylamino)-2-cyclopropylpropanoic acid.
| Compound Name | 2-(2-aminoethylcarbamoylamino)-2-cyclopropylpropanoic acid |
|---|---|
| PubChem CID | 61402734 |
| Molecular Formula | C9H17N3O3 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 2-(2-aminoethylcarbamoylamino)-2-cyclopropylpropanoic acid |
| SMILES | CC(NC(=O)NCCN)(C(=O)O)C1CC1 |
| InChI | InChI=1S/C9H17N3O3/c1-9(7(13)14,6-2-3-6)12-8(15)11-5-4-10/h6H,2-5,10H2,1H3,(H,13,14)(H2,11,12,15) |
| InChIKey | APFLLZCQZVLEKI-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |