C12H19F3N2O3 — CID 115521493
2-cyclopropyl-2-(5,5,5-trifluoropentylcarbamoylamino)propanoic acid (PubChem CID 115521493) has the molecular formula C12H19F3N2O3 and a molecular weight of 296.29 g/mol. Its IUPAC name is 2-cyclopropyl-2-(5,5,5-trifluoropentylcarbamoylamino)propanoic acid.
| Compound Name | 2-cyclopropyl-2-(5,5,5-trifluoropentylcarbamoylamino)propanoic acid |
|---|---|
| PubChem CID | 115521493 |
| Molecular Formula | C12H19F3N2O3 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 2-cyclopropyl-2-(5,5,5-trifluoropentylcarbamoylamino)propanoic acid |
| SMILES | CC(NC(=O)NCCCCC(F)(F)F)(C(=O)O)C1CC1 |
| InChI | InChI=1S/C12H19F3N2O3/c1-11(9(18)19,8-4-5-8)17-10(20)16-7-3-2-6-12(13,14)15/h8H,2-7H2,1H3,(H,18,19)(H2,16,17,20) |
| InChIKey | CJRZEJVEKCLAAM-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|