C12H19N3O4 — CID 16786947
2-cyclopropyl-2-[[2-(cyclopropylamino)-2-oxoethyl]carbamoylamino]propanoic acid (PubChem CID 16786947) has the molecular formula C12H19N3O4 and a molecular weight of 269.30 g/mol. Its IUPAC name is 2-cyclopropyl-2-[[2-(cyclopropylamino)-2-oxoethyl]carbamoylamino]propanoic acid.
| Compound Name | 2-cyclopropyl-2-[[2-(cyclopropylamino)-2-oxoethyl]carbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 16786947 |
| Molecular Formula | C12H19N3O4 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 2-cyclopropyl-2-[[2-(cyclopropylamino)-2-oxoethyl]carbamoylamino]propanoic acid |
| SMILES | CC(NC(=O)NCC(=O)NC1CC1)(C(=O)O)C1CC1 |
| InChI | InChI=1S/C12H19N3O4/c1-12(10(17)18,7-2-3-7)15-11(19)13-6-9(16)14-8-4-5-8/h7-8H,2-6H2,1H3,(H,14,16)(H,17,18)(H2,13,15,19) |
| InChIKey | GPCPWGYWPYRHPQ-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |