C8H11F2NO3 — CID 103513145
2-cyclopropyl-2-[(2,2-difluoroacetyl)amino]propanoic acid (PubChem CID 103513145) has the molecular formula C8H11F2NO3 and a molecular weight of 207.18 g/mol. Its IUPAC name is 2-cyclopropyl-2-[(2,2-difluoroacetyl)amino]propanoic acid.
| Compound Name | 2-cyclopropyl-2-[(2,2-difluoroacetyl)amino]propanoic acid |
|---|---|
| PubChem CID | 103513145 |
| Molecular Formula | C8H11F2NO3 |
| Molecular Weight | 207.18 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 2-cyclopropyl-2-[(2,2-difluoroacetyl)amino]propanoic acid |
| SMILES | CC(NC(=O)C(F)F)(C(=O)O)C1CC1 |
| InChI | InChI=1S/C8H11F2NO3/c1-8(7(13)14,4-2-3-4)11-6(12)5(9)10/h4-5H,2-3H2,1H3,(H,11,12)(H,13,14) |
| InChIKey | ORAQZDMDSUJSHJ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.18 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |