C8H18N2 — CID 130656147
1-N-ethyl-1-N-methylpent-4-ene-1,2-diamine (PubChem CID 130656147) has the molecular formula C8H18N2 and a molecular weight of 142.25 g/mol. Its IUPAC name is 1-N-ethyl-1-N-methylpent-4-ene-1,2-diamine.
| Compound Name | 1-N-ethyl-1-N-methylpent-4-ene-1,2-diamine |
|---|---|
| PubChem CID | 130656147 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | 1-N-ethyl-1-N-methylpent-4-ene-1,2-diamine |
| SMILES | C=CCC(N)CN(C)CC |
| InChI | InChI=1S/C8H18N2/c1-4-6-8(9)7-10(3)5-2/h4,8H,1,5-7,9H2,2-3H3 |
| InChIKey | JTNUXGLJVMQCQE-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|