C10H21NO5 — CID 130321877
2,3,4,5-tetrahydroxy-N-pentan-2-ylpentanamide (PubChem CID 130321877) has the molecular formula C10H21NO5 and a molecular weight of 235.28 g/mol. Its IUPAC name is 2,3,4,5-tetrahydroxy-N-pentan-2-ylpentanamide.
| Compound Name | 2,3,4,5-tetrahydroxy-N-pentan-2-ylpentanamide |
|---|---|
| PubChem CID | 130321877 |
| Molecular Formula | C10H21NO5 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 2,3,4,5-tetrahydroxy-N-pentan-2-ylpentanamide |
| SMILES | CCCC(C)NC(=O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C10H21NO5/c1-3-4-6(2)11-10(16)9(15)8(14)7(13)5-12/h6-9,12-15H,3-5H2,1-2H3,(H,11,16) |
| InChIKey | YQALQTXCOFVWMR-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |