C17H37N3O12 — CID 143162237
N-[2-[2-(1,2,3,4,5,6-hexahydroxyhexylamino)ethyl-methylamino]ethyl]-2,3,4,5,6-pentahydroxyhexanamide (PubChem CID 143162237) has the molecular formula C17H37N3O12 and a molecular weight of 475.49 g/mol. Its IUPAC name is N-[2-[2-(1,2,3,4,5,6-hexahydroxyhexylamino)ethyl-methylamino]ethyl]-2,3,4,5,6-pentahydroxyhexanamide.
| Compound Name | N-[2-[2-(1,2,3,4,5,6-hexahydroxyhexylamino)ethyl-methylamino]ethyl]-2,3,4,5,6-pentahydroxyhexanamide |
|---|---|
| PubChem CID | 143162237 |
| Molecular Formula | C17H37N3O12 |
| Molecular Weight | 475.49 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | N-[2-[2-(1,2,3,4,5,6-hexahydroxyhexylamino)ethyl-methylamino]ethyl]-2,3,4,5,6-pentahydroxyhexanamide |
| SMILES | CN(CCNC(=O)C(O)C(O)C(O)C(O)CO)CCNC(O)C(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C17H37N3O12/c1-20(4-2-18-16(31)14(29)12(27)10(25)8(23)6-21)5-3-19-17(32)15(30)13(28)11(26)9(24)7-22/h8-16,18,21-31H,2-7H2,1H3,(H,19,32) |
| InChIKey | HCXAGDWFNZPTLB-UHFFFAOYSA-N |
| XLogP | -8.19 |
| TPSA | 266.90 Ų |
| H-Bond Donors | 13 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.49 |
| LogP ≤ 5 | -8.19 |
| H-Bond Donors ≤ 5 | 13 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|