C18H33N3O6 — CID 160929426
diethyl 2-[3-(2,6-diaminohexanoylamino)-2-oxopropyl]pentanedioate (PubChem CID 160929426) has the molecular formula C18H33N3O6 and a molecular weight of 387.48 g/mol. Its IUPAC name is diethyl 2-[3-(2,6-diaminohexanoylamino)-2-oxopropyl]pentanedioate.
| Compound Name | diethyl 2-[3-(2,6-diaminohexanoylamino)-2-oxopropyl]pentanedioate |
|---|---|
| PubChem CID | 160929426 |
| Molecular Formula | C18H33N3O6 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | diethyl 2-[3-(2,6-diaminohexanoylamino)-2-oxopropyl]pentanedioate |
| SMILES | CCOC(=O)CCC(CC(=O)CNC(=O)C(N)CCCCN)C(=O)OCC |
| InChI | InChI=1S/C18H33N3O6/c1-3-26-16(23)9-8-13(18(25)27-4-2)11-14(22)12-21-17(24)15(20)7-5-6-10-19/h13,15H,3-12,19-20H2,1-2H3,(H,21,24) |
| InChIKey | QQSPLAWGBXHHOC-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 150.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|