C17H33N3O3 — CID 177135798
N-(5-amino-7-methyl-6-oxooctyl)-4-(2-methylpropanoylamino)butanamide (PubChem CID 177135798) has the molecular formula C17H33N3O3 and a molecular weight of 327.47 g/mol. Its IUPAC name is N-(5-amino-7-methyl-6-oxooctyl)-4-(2-methylpropanoylamino)butanamide.
| Compound Name | N-(5-amino-7-methyl-6-oxooctyl)-4-(2-methylpropanoylamino)butanamide |
|---|---|
| PubChem CID | 177135798 |
| Molecular Formula | C17H33N3O3 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.25 |
| IUPAC Name | N-(5-amino-7-methyl-6-oxooctyl)-4-(2-methylpropanoylamino)butanamide |
| SMILES | CC(C)C(=O)NCCCC(=O)NCCCCC(N)C(=O)C(C)C |
| InChI | InChI=1S/C17H33N3O3/c1-12(2)16(22)14(18)8-5-6-10-19-15(21)9-7-11-20-17(23)13(3)4/h12-14H,5-11,18H2,1-4H3,(H,19,21)(H,20,23) |
| InChIKey | HMMJMDUEARUWOS-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|