C21H42N3O5+ — CID 170613768
2-[2-[3-[[5-(3-hydroxypyrrolidin-1-yl)-3,3-dimethyl-5-oxopentyl]amino]-3-oxopropoxy]ethoxy]ethyl-trimethylazanium (PubChem CID 170613768) has the molecular formula C21H42N3O5+ and a molecular weight of 416.58 g/mol. Its IUPAC name is 2-[2-[3-[[5-(3-hydroxypyrrolidin-1-yl)-3,3-dimethyl-5-oxopentyl]amino]-3-oxopropoxy]ethoxy]ethyl-trimethylazanium.
| Compound Name | 2-[2-[3-[[5-(3-hydroxypyrrolidin-1-yl)-3,3-dimethyl-5-oxopentyl]amino]-3-oxopropoxy]ethoxy]ethyl-trimethylazanium |
|---|---|
| PubChem CID | 170613768 |
| Molecular Formula | C21H42N3O5+ |
| Molecular Weight | 416.58 g/mol |
| Exact Mass | 416.31 |
| IUPAC Name | 2-[2-[3-[[5-(3-hydroxypyrrolidin-1-yl)-3,3-dimethyl-5-oxopentyl]amino]-3-oxopropoxy]ethoxy]ethyl-trimethylazanium |
| SMILES | CC(C)(CCNC(=O)CCOCCOCC[N+](C)(C)C)CC(=O)N1CCC(O)C1 |
| InChI | InChI=1S/C21H41N3O5/c1-21(2,16-20(27)23-10-6-18(25)17-23)8-9-22-19(26)7-12-28-14-15-29-13-11-24(3,4)5/h18,25H,6-17H2,1-5H3/p+1 |
| InChIKey | LSNPBDAEUQSBHY-UHFFFAOYSA-O |
| XLogP | 0.63 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.58 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|