C18H32N2O13P2 — CID 59449910
[4-[2-[2-[2-[2-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]ethoxy]ethoxy]ethoxy]ethylamino]-4-oxo-1-phosphonobutyl]phosphonic acid (PubChem CID 59449910) has the molecular formula C18H32N2O13P2 and a molecular weight of 546.40 g/mol. Its IUPAC name is [4-[2-[2-[2-[2-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]ethoxy]ethoxy]ethoxy]ethylamino]-4-oxo-1-phosphonobutyl]phosphonic acid.
| Compound Name | [4-[2-[2-[2-[2-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]ethoxy]ethoxy]ethoxy]ethylamino]-4-oxo-1-phosphonobutyl]phosphonic acid |
|---|---|
| PubChem CID | 59449910 |
| Molecular Formula | C18H32N2O13P2 |
| Molecular Weight | 546.40 g/mol |
| Exact Mass | 546.14 |
| IUPAC Name | [4-[2-[2-[2-[2-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]ethoxy]ethoxy]ethoxy]ethylamino]-4-oxo-1-phosphonobutyl]phosphonic acid |
| SMILES | CCOc1c(NCCOCCOCCOCCNC(=O)CCC(P(=O)(O)O)P(=O)(O)O)c(=O)c1=O |
| InChI | InChI=1S/C18H32N2O13P2/c1-2-33-18-15(16(22)17(18)23)20-6-8-31-10-12-32-11-9-30-7-5-19-13(21)3-4-14(34(24,25)26)35(27,28)29/h14,20H,2-12H2,1H3,(H,19,21)(H2,24,25,26)(H2,27,28,29) |
| InChIKey | NTAKLCKZLNMDEQ-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 227.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.40 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|