C7H11NO5 — CID 146258348
2-methoxyethyl (E)-3-hydroxy-2-nitrosobut-2-enoate (PubChem CID 146258348) has the molecular formula C7H11NO5 and a molecular weight of 189.17 g/mol. Its IUPAC name is 2-methoxyethyl (E)-3-hydroxy-2-nitrosobut-2-enoate.
| Compound Name | 2-methoxyethyl (E)-3-hydroxy-2-nitrosobut-2-enoate |
|---|---|
| PubChem CID | 146258348 |
| Molecular Formula | C7H11NO5 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | 2-methoxyethyl (E)-3-hydroxy-2-nitrosobut-2-enoate |
| SMILES | COCCOC(=O)/C(N=O)=C(/C)O |
| InChI | InChI=1S/C7H11NO5/c1-5(9)6(8-11)7(10)13-4-3-12-2/h9H,3-4H2,1-2H3/b6-5+ |
| InChIKey | WQUVGDIPJQZLCI-AATRIKPKSA-N |
| XLogP | 0.73 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|