About methyl (2S)-6-amino-2-methylhexanoate;methyl (2S)-2-methylheptanoate
methyl (2S)-6-amino-2-methylhexanoate;methyl (2S)-2-methylheptanoate (PubChem CID 161175791) has the molecular formula C17H35NO4
and a molecular weight of 317.47 g/mol. Its IUPAC name is methyl (2S)-6-amino-2-methylhexanoate;methyl (2S)-2-methylheptanoate.
Molecular Properties
| Compound Name | methyl (2S)-6-amino-2-methylhexanoate;methyl (2S)-2-methylheptanoate |
| PubChem CID | 161175791 |
| Molecular Formula | C17H35NO4 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.26 |
| IUPAC Name | methyl (2S)-6-amino-2-methylhexanoate;methyl (2S)-2-methylheptanoate |
| SMILES | CCCCC[C@H](C)C(=O)OC.COC(=O)[C@@H](C)CCCCN |
| InChI | InChI=1S/C9H18O2.C8H17NO2/c1-4-5-6-7-8(2)9(10)11-3;1-7(8(10)11-2)5-3-4-6-9/h8H,4-7H2,1-3H3;7H,3-6,9H2,1-2H3/t8-;7-/m00/s1 |
| InChIKey | URUDRIGSSQUFFS-GZTXQBDSSA-N |
| XLogP | 3.30 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl (2S)-6-amino-2-methylhexanoate;methyl (2S)-2-methylheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-6-amino-2-methylhexanoate;methyl (2S)-2-methylheptanoate?
The IUPAC name of methyl (2S)-6-amino-2-methylhexanoate;methyl (2S)-2-methylheptanoate (CID 161175791) is methyl (2S)-6-amino-2-methylhexanoate;methyl (2S)-2-methylheptanoate.
What is the SMILES notation for methyl (2S)-6-amino-2-methylhexanoate;methyl (2S)-2-methylheptanoate?
The canonical SMILES for methyl (2S)-6-amino-2-methylhexanoate;methyl (2S)-2-methylheptanoate is CCCCC[C@H](C)C(=O)OC.COC(=O)[C@@H](C)CCCCN.
What is the InChIKey of methyl (2S)-6-amino-2-methylhexanoate;methyl (2S)-2-methylheptanoate?
The InChIKey is URUDRIGSSQUFFS-GZTXQBDSSA-N. The full InChI is InChI=1S/C9H18O2.C8H17NO2/c1-4-5-6-7-8(2)9(10)11-3;1-7(8(10)11-2)5-3-4-6-9/h8H,4-7H2,1-3H3;7H,3-6,9H2,1-2H3/t8-;7-/m00/s1.
What are the key properties of methyl (2S)-6-amino-2-methylhexanoate;methyl (2S)-2-methylheptanoate?
methyl (2S)-6-amino-2-methylhexanoate;methyl (2S)-2-methylheptanoate has a molecular weight of 317.47 g/mol, XLogP of 3.30, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-6-amino-2-methylhexanoate;methyl (2S)-2-methylheptanoate is sourced from PubChem (CID 161175791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).