C7H15NO3 — CID 147676110
(2S)-4-hydroxy-4-methoxy-N,2-dimethylbutanamide (PubChem CID 147676110) has the molecular formula C7H15NO3 and a molecular weight of 161.20 g/mol. Its IUPAC name is (2S)-4-hydroxy-4-methoxy-N,2-dimethylbutanamide.
| Compound Name | (2S)-4-hydroxy-4-methoxy-N,2-dimethylbutanamide |
|---|---|
| PubChem CID | 147676110 |
| Molecular Formula | C7H15NO3 |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.11 |
| IUPAC Name | (2S)-4-hydroxy-4-methoxy-N,2-dimethylbutanamide |
| SMILES | CNC(=O)[C@@H](C)CC(O)OC |
| InChI | InChI=1S/C7H15NO3/c1-5(7(10)8-2)4-6(9)11-3/h5-6,9H,4H2,1-3H3,(H,8,10)/t5-,6?/m0/s1 |
| InChIKey | GOEUCISIAVQDGE-ZBHICJROSA-N |
| XLogP | -0.28 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|