C11H17NO3S — CID 142750639
methyl (2S)-2-[2-(hydroxymethyl)pyrrol-1-yl]-4-methylsulfanylbutanoate (PubChem CID 142750639) has the molecular formula C11H17NO3S and a molecular weight of 243.33 g/mol. Its IUPAC name is methyl (2S)-2-[2-(hydroxymethyl)pyrrol-1-yl]-4-methylsulfanylbutanoate.
| Compound Name | methyl (2S)-2-[2-(hydroxymethyl)pyrrol-1-yl]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 142750639 |
| Molecular Formula | C11H17NO3S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | methyl (2S)-2-[2-(hydroxymethyl)pyrrol-1-yl]-4-methylsulfanylbutanoate |
| SMILES | COC(=O)[C@H](CCSC)n1cccc1CO |
| InChI | InChI=1S/C11H17NO3S/c1-15-11(14)10(5-7-16-2)12-6-3-4-9(12)8-13/h3-4,6,10,13H,5,7-8H2,1-2H3/t10-/m0/s1 |
| InChIKey | YWXJEWBTRNKQAS-JTQLQIEISA-N |
| XLogP | 1.45 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |