C13H14ClNO3S — CID 168707797
3-(2-chlorophenyl)-3-(2-oxo-4-sulfanylpyrrolidin-1-yl)propanoic acid (PubChem CID 168707797) has the molecular formula C13H14ClNO3S and a molecular weight of 299.78 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-3-(2-oxo-4-sulfanylpyrrolidin-1-yl)propanoic acid.
| Compound Name | 3-(2-chlorophenyl)-3-(2-oxo-4-sulfanylpyrrolidin-1-yl)propanoic acid |
|---|---|
| PubChem CID | 168707797 |
| Molecular Formula | C13H14ClNO3S |
| Molecular Weight | 299.78 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 3-(2-chlorophenyl)-3-(2-oxo-4-sulfanylpyrrolidin-1-yl)propanoic acid |
| SMILES | O=C(O)CC(c1ccccc1Cl)N1CC(S)CC1=O |
| InChI | InChI=1S/C13H14ClNO3S/c14-10-4-2-1-3-9(10)11(6-13(17)18)15-7-8(19)5-12(15)16/h1-4,8,11,19H,5-7H2,(H,17,18) |
| InChIKey | WTJMHVRKZVHWIM-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.78 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|