C13H13BrClNO3 — CID 168687035
3-(4-bromophenyl)-3-(4-chloro-2-oxopyrrolidin-1-yl)propanoic acid (PubChem CID 168687035) has the molecular formula C13H13BrClNO3 and a molecular weight of 346.61 g/mol. Its IUPAC name is 3-(4-bromophenyl)-3-(4-chloro-2-oxopyrrolidin-1-yl)propanoic acid.
| Compound Name | 3-(4-bromophenyl)-3-(4-chloro-2-oxopyrrolidin-1-yl)propanoic acid |
|---|---|
| PubChem CID | 168687035 |
| Molecular Formula | C13H13BrClNO3 |
| Molecular Weight | 346.61 g/mol |
| Exact Mass | 344.98 |
| IUPAC Name | 3-(4-bromophenyl)-3-(4-chloro-2-oxopyrrolidin-1-yl)propanoic acid |
| SMILES | O=C(O)CC(c1ccc(Br)cc1)N1CC(Cl)CC1=O |
| InChI | InChI=1S/C13H13BrClNO3/c14-9-3-1-8(2-4-9)11(6-13(18)19)16-7-10(15)5-12(16)17/h1-4,10-11H,5-7H2,(H,18,19) |
| InChIKey | PKOBOTKVZIREDV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.61 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|