C12H13F3N2O — CID 168699945
4-amino-1-[2-methyl-6-(trifluoromethyl)phenyl]pyrrolidin-2-one (PubChem CID 168699945) has the molecular formula C12H13F3N2O and a molecular weight of 258.24 g/mol. Its IUPAC name is 4-amino-1-[2-methyl-6-(trifluoromethyl)phenyl]pyrrolidin-2-one.
| Compound Name | 4-amino-1-[2-methyl-6-(trifluoromethyl)phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 168699945 |
| Molecular Formula | C12H13F3N2O |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 4-amino-1-[2-methyl-6-(trifluoromethyl)phenyl]pyrrolidin-2-one |
| SMILES | Cc1cccc(C(F)(F)F)c1N1CC(N)CC1=O |
| InChI | InChI=1S/C12H13F3N2O/c1-7-3-2-4-9(12(13,14)15)11(7)17-6-8(16)5-10(17)18/h2-4,8H,5-6,16H2,1H3 |
| InChIKey | QDLBRGBKJAYTGO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |