C10H9ClN2O4 — CID 168703795
2-chloro-6-(4-hydroxy-2-oxopyrrolidin-1-yl)pyridine-4-carboxylic acid (PubChem CID 168703795) has the molecular formula C10H9ClN2O4 and a molecular weight of 256.64 g/mol. Its IUPAC name is 2-chloro-6-(4-hydroxy-2-oxopyrrolidin-1-yl)pyridine-4-carboxylic acid.
| Compound Name | 2-chloro-6-(4-hydroxy-2-oxopyrrolidin-1-yl)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 168703795 |
| Molecular Formula | C10H9ClN2O4 |
| Molecular Weight | 256.64 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | 2-chloro-6-(4-hydroxy-2-oxopyrrolidin-1-yl)pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1cc(Cl)nc(N2CC(O)CC2=O)c1 |
| InChI | InChI=1S/C10H9ClN2O4/c11-7-1-5(10(16)17)2-8(12-7)13-4-6(14)3-9(13)15/h1-2,6,14H,3-4H2,(H,16,17) |
| InChIKey | VPULOSQBEHVOJC-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.64 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|