C10H11ClN2O4 — CID 106669843
2-chloro-6-(3,4-dihydroxypyrrolidin-1-yl)pyridine-4-carboxylic acid (PubChem CID 106669843) has the molecular formula C10H11ClN2O4 and a molecular weight of 258.66 g/mol. Its IUPAC name is 2-chloro-6-(3,4-dihydroxypyrrolidin-1-yl)pyridine-4-carboxylic acid.
| Compound Name | 2-chloro-6-(3,4-dihydroxypyrrolidin-1-yl)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 106669843 |
| Molecular Formula | C10H11ClN2O4 |
| Molecular Weight | 258.66 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 2-chloro-6-(3,4-dihydroxypyrrolidin-1-yl)pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1cc(Cl)nc(N2CC(O)C(O)C2)c1 |
| InChI | InChI=1S/C10H11ClN2O4/c11-8-1-5(10(16)17)2-9(12-8)13-3-6(14)7(15)4-13/h1-2,6-7,14-15H,3-4H2,(H,16,17) |
| InChIKey | SVXARVUUNUCABS-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.66 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|