C13H18ClN3O2 — CID 61404286
2-chloro-6-[3-(methylaminomethyl)piperidin-1-yl]pyridine-4-carboxylic acid (PubChem CID 61404286) has the molecular formula C13H18ClN3O2 and a molecular weight of 283.76 g/mol. Its IUPAC name is 2-chloro-6-[3-(methylaminomethyl)piperidin-1-yl]pyridine-4-carboxylic acid.
| Compound Name | 2-chloro-6-[3-(methylaminomethyl)piperidin-1-yl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 61404286 |
| Molecular Formula | C13H18ClN3O2 |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 2-chloro-6-[3-(methylaminomethyl)piperidin-1-yl]pyridine-4-carboxylic acid |
| SMILES | CNCC1CCCN(c2cc(C(=O)O)cc(Cl)n2)C1 |
| InChI | InChI=1S/C13H18ClN3O2/c1-15-7-9-3-2-4-17(8-9)12-6-10(13(18)19)5-11(14)16-12/h5-6,9,15H,2-4,7-8H2,1H3,(H,18,19) |
| InChIKey | KIKAITPWQCWXOU-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|