C12H12N8O — CID 168657810
4-(azidomethyl)-1-[4-(2H-tetrazol-5-yl)phenyl]pyrrolidin-2-one (PubChem CID 168657810) has the molecular formula C12H12N8O and a molecular weight of 284.28 g/mol. Its IUPAC name is 4-(azidomethyl)-1-[4-(2H-tetrazol-5-yl)phenyl]pyrrolidin-2-one.
| Compound Name | 4-(azidomethyl)-1-[4-(2H-tetrazol-5-yl)phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 168657810 |
| Molecular Formula | C12H12N8O |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 4-(azidomethyl)-1-[4-(2H-tetrazol-5-yl)phenyl]pyrrolidin-2-one |
| SMILES | [N-]=[N+]=NCC1CC(=O)N(c2ccc(-c3nn[nH]n3)cc2)C1 |
| InChI | InChI=1S/C12H12N8O/c13-17-14-6-8-5-11(21)20(7-8)10-3-1-9(2-4-10)12-15-18-19-16-12/h1-4,8H,5-7H2,(H,15,16,18,19) |
| InChIKey | QQPRDDPBYTTWRC-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 123.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|