C13H12N6O2S — CID 168657805
4-(azidomethyl)-1-[4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)phenyl]pyrrolidin-2-one (PubChem CID 168657805) has the molecular formula C13H12N6O2S and a molecular weight of 316.35 g/mol. Its IUPAC name is 4-(azidomethyl)-1-[4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)phenyl]pyrrolidin-2-one.
| Compound Name | 4-(azidomethyl)-1-[4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 168657805 |
| Molecular Formula | C13H12N6O2S |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 4-(azidomethyl)-1-[4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)phenyl]pyrrolidin-2-one |
| SMILES | [N-]=[N+]=NCC1CC(=O)N(c2ccc(-c3n[nH]c(=S)o3)cc2)C1 |
| InChI | InChI=1S/C13H12N6O2S/c14-18-15-6-8-5-11(20)19(7-8)10-3-1-9(2-4-10)12-16-17-13(22)21-12/h1-4,8H,5-7H2,(H,17,22) |
| InChIKey | LKHOOENDQQBNRK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 110.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|