C9H11BrFN3O3S — CID 168676235
[1-(4-bromo-5-methyl-1H-pyrazol-3-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168676235) has the molecular formula C9H11BrFN3O3S and a molecular weight of 340.17 g/mol. Its IUPAC name is [1-(4-bromo-5-methyl-1H-pyrazol-3-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
| Compound Name | [1-(4-bromo-5-methyl-1H-pyrazol-3-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
|---|---|
| PubChem CID | 168676235 |
| Molecular Formula | C9H11BrFN3O3S |
| Molecular Weight | 340.17 g/mol |
| Exact Mass | 338.97 |
| IUPAC Name | [1-(4-bromo-5-methyl-1H-pyrazol-3-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | Cc1[nH]nc(N2CC(CS(=O)(=O)F)CC2=O)c1Br |
| InChI | InChI=1S/C9H11BrFN3O3S/c1-5-8(10)9(13-12-5)14-3-6(2-7(14)15)4-18(11,16)17/h6H,2-4H2,1H3,(H,12,13) |
| InChIKey | NFCRHEHELJFNDW-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.17 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |