C15H16FN3O3S — CID 168676288
[1-(1-methyl-3-phenylpyrazol-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168676288) has the molecular formula C15H16FN3O3S and a molecular weight of 337.38 g/mol. Its IUPAC name is [1-(1-methyl-3-phenylpyrazol-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
| Compound Name | [1-(1-methyl-3-phenylpyrazol-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
|---|---|
| PubChem CID | 168676288 |
| Molecular Formula | C15H16FN3O3S |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | [1-(1-methyl-3-phenylpyrazol-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | Cn1nc(-c2ccccc2)cc1N1CC(CS(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C15H16FN3O3S/c1-18-14(8-13(17-18)12-5-3-2-4-6-12)19-9-11(7-15(19)20)10-23(16,21)22/h2-6,8,11H,7,9-10H2,1H3 |
| InChIKey | DRSDIHKORNBJFG-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |